CAS 2059277-11-9 is the registry number for (S)-6-Methyl-4,5,6,7-tetrahydrobenzo[d]thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (CAS 2059277-11-9) is a chemical compound with the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. IUPAC name: (6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine. InChIKey: PWQFLEIGKAIACN-YFKPBYRVSA-N.
| Molecular formula | C8H12N2S |
|---|---|
| Molecular weight | 168.26 g/mol |
| IUPAC name | (6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| InChIKey | PWQFLEIGKAIACN-YFKPBYRVSA-N |
| SMILES | C[C@H]1CCC2=C(C1)SC(=N2)N |
Computed by PubChem (NCBI)