CAS 2059911-21-4 is the registry number for tert-Butyl (2R,4R)-2-methylpiperidine-4-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Tert-butyl (2R,4R)-2-methylpiperidine-4-carboxylate (CAS 2059911-21-4) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl (2R,4R)-2-methylpiperidine-4-carboxylate. InChIKey: HFBOJERZOWTWDR-RKDXNWHRSA-N.
| Molecular formula | C11H21NO2 |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | tert-butyl (2R,4R)-2-methylpiperidine-4-carboxylate |
| InChIKey | HFBOJERZOWTWDR-RKDXNWHRSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)