Products 2059927-80-7
CAS 2059927-80-7 is the registry number for 3-(Chloromethyl)-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(chloromethyl)-1,5-dimethylpyrazole-4-sulfonyl chloride (CAS 2059927-80-7) is a chemical compound with the molecular formula C6H8Cl2N2O2S and a molecular weight of 243.11 g/mol. IUPAC name: 3-(chloromethyl)-1,5-dimethylpyrazole-4-sulfonyl chloride. InChIKey: LAIGDCOHBNBJEV-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2N2O2S |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 3-(chloromethyl)-1,5-dimethylpyrazole-4-sulfonyl chloride |
| InChIKey | LAIGDCOHBNBJEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)CCl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)