CAS 2059932-59-9 appears in our catalog under these names: Ethyl 2-amino-3-hydroxy-3-(pyridin-3-yl)propanoate dihydrochloride, 95%, Ethyl 2-amino-3-hydroxy-3-(pyridin-3-yl)propanoate dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 2-amino-3-hydroxy-3-pyridin-3-ylpropanoate;dihydrochloride (CAS 2059932-59-9) is a chemical compound with the molecular formula C10H16Cl2N2O3 and a molecular weight of 283.15 g/mol. IUPAC name: ethyl 2-amino-3-hydroxy-3-pyridin-3-ylpropanoate;dihydrochloride. InChIKey: YBKGHKVWNYKYEZ-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O3 |
|---|---|
| Molecular weight | 283.15 g/mol |
| IUPAC name | ethyl 2-amino-3-hydroxy-3-pyridin-3-ylpropanoate;dihydrochloride |
| InChIKey | YBKGHKVWNYKYEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C1=CN=CC=C1)O)N.Cl.Cl |
Computed by PubChem (NCBI)