CAS 2059932-66-8 appears in our catalog under these names: Methyl 2-(5-bromothiophen-2-yl)-2-(methylamino)acetate hydrochloride, 95%, Methyl 2–(5–bromothiophen–2–yl)–2–(methylamino)acetate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
Methyl 2-(5-bromothiophen-2-yl)-2-(methylamino)acetate;hydrochloride (CAS 2059932-66-8) is a chemical compound with the molecular formula C8H11BrClNO2S and a molecular weight of 300.60 g/mol. IUPAC name: methyl 2-(5-bromothiophen-2-yl)-2-(methylamino)acetate;hydrochloride. InChIKey: GMIVUJBZBDVPKW-UHFFFAOYSA-N.
| Molecular formula | C8H11BrClNO2S |
|---|---|
| Molecular weight | 300.60 g/mol |
| IUPAC name | methyl 2-(5-bromothiophen-2-yl)-2-(methylamino)acetate;hydrochloride |
| InChIKey | GMIVUJBZBDVPKW-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC=C(S1)Br)C(=O)OC.Cl |
Computed by PubChem (NCBI)