CAS 2059935-73-6 is the registry number for (2,4-Difluoro-5-iodophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,4-difluoro-5-iodophenyl)methanamine;hydrochloride (CAS 2059935-73-6) is a chemical compound with the molecular formula C7H7ClF2IN and a molecular weight of 305.49 g/mol. IUPAC name: (2,4-difluoro-5-iodophenyl)methanamine;hydrochloride. InChIKey: RBUCYJCXIKDROK-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF2IN |
|---|---|
| Molecular weight | 305.49 g/mol |
| IUPAC name | (2,4-difluoro-5-iodophenyl)methanamine;hydrochloride |
| InChIKey | RBUCYJCXIKDROK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)F)F)CN.Cl |
Computed by PubChem (NCBI)