CAS 2059937-11-8 is the registry number for 6-Fluoro-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-fluoro-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride (CAS 2059937-11-8) is a chemical compound with the molecular formula C10H10ClFO2S and a molecular weight of 248.70 g/mol. IUPAC name: 6-fluoro-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride. InChIKey: ZUMJJYIQVSJEFR-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2S |
|---|---|
| Molecular weight | 248.70 g/mol |
| IUPAC name | 6-fluoro-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride |
| InChIKey | ZUMJJYIQVSJEFR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1S(=O)(=O)Cl)C=CC(=C2)F |
Computed by PubChem (NCBI)