CAS 2059938-34-8 is the registry number for (2-Bromo-6-fluoro-3-(trifluoromethyl)phenyl)trimethylsilane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]-trimethylsilane (CAS 2059938-34-8) is a chemical compound with the molecular formula C10H11BrF4Si and a molecular weight of 315.18 g/mol. IUPAC name: [2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]-trimethylsilane. InChIKey: FFHHKFOQQMJKIL-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF4Si |
|---|---|
| Molecular weight | 315.18 g/mol |
| IUPAC name | [2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]-trimethylsilane |
| InChIKey | FFHHKFOQQMJKIL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC(=C1Br)C(F)(F)F)F |
Computed by PubChem (NCBI)