CAS 2059948-79-5 is the registry number for 5-Chloropyrazolo(1,5-a)pyrimidine-3-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloropyrazolo[1,5-a]pyrimidine-3-sulfonyl fluoride (CAS 2059948-79-5) is a chemical compound with the molecular formula C6H3ClFN3O2S and a molecular weight of 235.62 g/mol. IUPAC name: 5-chloropyrazolo[1,5-a]pyrimidine-3-sulfonyl fluoride. InChIKey: SROGVDAUBOTNMP-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFN3O2S |
|---|---|
| Molecular weight | 235.62 g/mol |
| IUPAC name | 5-chloropyrazolo[1,5-a]pyrimidine-3-sulfonyl fluoride |
| InChIKey | SROGVDAUBOTNMP-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)S(=O)(=O)F)N=C1Cl |
Computed by PubChem (NCBI)