CAS 2060-91-5 is the registry number for Mesityltrimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Trimethyl-(2,4,6-trimethylphenyl)silane (CAS 2060-91-5) is a chemical compound with the molecular formula C12H20Si and a molecular weight of 192.37 g/mol. IUPAC name: trimethyl-(2,4,6-trimethylphenyl)silane. InChIKey: VYMJDWJKSWONJQ-UHFFFAOYSA-N.
| Molecular formula | C12H20Si |
|---|---|
| Molecular weight | 192.37 g/mol |
| IUPAC name | trimethyl-(2,4,6-trimethylphenyl)silane |
| InChIKey | VYMJDWJKSWONJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[Si](C)(C)C)C |
Computed by PubChem (NCBI)