Products 2060020-62-2

CAS 2060020-62-2 is the registry number for 3-(Propan-2-yloxy)azetidine methanesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methanesulfonic acid;3-propan-2-yloxyazetidine (CAS 2060020-62-2) is a chemical compound with the molecular formula C7H17NO4S and a molecular weight of 211.28 g/mol. IUPAC name: methanesulfonic acid;3-propan-2-yloxyazetidine. InChIKey: QCAWGANZEJJXNN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H17NO4S
Molecular weight211.28 g/mol
IUPAC namemethanesulfonic acid;3-propan-2-yloxyazetidine
InChIKeyQCAWGANZEJJXNN-UHFFFAOYSA-N
SMILESCC(C)OC1CNC1.CS(=O)(=O)O

Computed by PubChem (NCBI)