CAS 2060029-71-0 appears in our catalog under these names: 3-(Azetidin-3-yl)-5-((tert-butoxy)methyl)-1,2-oxazole, methanesulfonic acid, 95%, 3-(Azetidin-3-yl)-5-((tert-butoxy)methyl)-1,2-oxazole methanesulfonic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(azetidin-3-yl)-5-[(2-methylpropan-2-yl)oxymethyl]-1,2-oxazole;methanesulfonic acid (CAS 2060029-71-0) is a chemical compound with the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. IUPAC name: 3-(azetidin-3-yl)-5-[(2-methylpropan-2-yl)oxymethyl]-1,2-oxazole;methanesulfonic acid. InChIKey: DOXKVPZCLPEYEP-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O5S |
|---|---|
| Molecular weight | 306.38 g/mol |
| IUPAC name | 3-(azetidin-3-yl)-5-[(2-methylpropan-2-yl)oxymethyl]-1,2-oxazole;methanesulfonic acid |
| InChIKey | DOXKVPZCLPEYEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OCC1=CC(=NO1)C2CNC2.CS(=O)(=O)O |
Computed by PubChem (NCBI)