CAS 2060036-05-5 is the registry number for 7,7-Dimethyl-1-phenyl-1H,4H,5H,6H,7H,8H-pyrazolo(4,3-c)azepine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7,7-dimethyl-1-phenyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine;dihydrochloride (CAS 2060036-05-5) is a chemical compound with the molecular formula C15H21Cl2N3 and a molecular weight of 314.3 g/mol. IUPAC name: 7,7-dimethyl-1-phenyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine;dihydrochloride. InChIKey: NOFCBWWKJMAUJI-UHFFFAOYSA-N.
| Molecular formula | C15H21Cl2N3 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 7,7-dimethyl-1-phenyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine;dihydrochloride |
| InChIKey | NOFCBWWKJMAUJI-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CNC1)C=NN2C3=CC=CC=C3)C.Cl.Cl |
Computed by PubChem (NCBI)