CAS 2060046-71-9 is the registry number for 4-Cyclopropyl-1-fluoro-2-(trifluoromethyl)benzene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-cyclopropyl-1-fluoro-2-(trifluoromethyl)benzene (CAS 2060046-71-9) is a chemical compound with the molecular formula C10H8F4 and a molecular weight of 204.16 g/mol. IUPAC name: 4-cyclopropyl-1-fluoro-2-(trifluoromethyl)benzene. InChIKey: BSIDOSMFXRIOOK-UHFFFAOYSA-N.
| Molecular formula | C10H8F4 |
|---|---|
| Molecular weight | 204.16 g/mol |
| IUPAC name | 4-cyclopropyl-1-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | BSIDOSMFXRIOOK-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)