CAS 2060052-54-0 is the registry number for 1H-Benzimidazole-2-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1H-benzimidazole-2-sulfonyl fluoride (CAS 2060052-54-0) is a chemical compound with the molecular formula C7H5FN2O2S and a molecular weight of 200.19 g/mol. IUPAC name: 1H-benzimidazole-2-sulfonyl fluoride. InChIKey: UHMGZCPRYPLLLN-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O2S |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 1H-benzimidazole-2-sulfonyl fluoride |
| InChIKey | UHMGZCPRYPLLLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)S(=O)(=O)F |
Computed by PubChem (NCBI)