Products 2060057-04-5
CAS 2060057-04-5 appears in our catalog under these names: Benzyl 2-((fluorosulfonyl)methyl)piperidine-1-carboxylate, 95%, Benzyl 2-((fluorosulfonyl)methyl)piperidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Benzyl 2-(fluorosulfonylmethyl)piperidine-1-carboxylate (CAS 2060057-04-5) is a chemical compound with the molecular formula C14H18FNO4S and a molecular weight of 315.36 g/mol. IUPAC name: benzyl 2-(fluorosulfonylmethyl)piperidine-1-carboxylate. InChIKey: CLVQKTFJCXYOIJ-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4S |
|---|---|
| Molecular weight | 315.36 g/mol |
| IUPAC name | benzyl 2-(fluorosulfonylmethyl)piperidine-1-carboxylate |
| InChIKey | CLVQKTFJCXYOIJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)CS(=O)(=O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)