CAS 2060060-40-2 appears in our catalog under these names: 2-(2-(3,3,3-Trifluoropropyl)-1,3-thiazol-4-yl)acetic acid hydrochloride, 2-(2-(3,3,3-Trifluoropropyl)-1,3-thiazol-4-yl)acetic acid hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride (CAS 2060060-40-2) is a chemical compound with the molecular formula C8H9ClF3NO2S and a molecular weight of 275.68 g/mol. IUPAC name: 2-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride. InChIKey: SDCJEHGTGBZDTO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO2S |
|---|---|
| Molecular weight | 275.68 g/mol |
| IUPAC name | 2-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride |
| InChIKey | SDCJEHGTGBZDTO-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)CCC(F)(F)F)CC(=O)O.Cl |
Computed by PubChem (NCBI)