CAS 2060062-39-5 appears in our catalog under these names: 4-(Aminomethyl)-2,6-difluorophenol hydrobromide, 4-(Aminomethyl)-2,6-difluorophenol hydrobromide, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
4-(aminomethyl)-2,6-difluorophenol;hydrobromide (CAS 2060062-39-5) is a chemical compound with the molecular formula C7H8BrF2NO and a molecular weight of 240.05 g/mol. IUPAC name: 4-(aminomethyl)-2,6-difluorophenol;hydrobromide. InChIKey: RNICADBIAXPMSX-UHFFFAOYSA-N.
| Molecular formula | C7H8BrF2NO |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 4-(aminomethyl)-2,6-difluorophenol;hydrobromide |
| InChIKey | RNICADBIAXPMSX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)O)F)CN.Br |
Computed by PubChem (NCBI)