CAS 2060522-86-1 is the registry number for tert-Butyl 3-(N-hydroxycarbamimidoyl)-8-azabicyclo(3.2.1)octane-8-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 2060522-86-1) is a chemical compound with the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: TWVHPVFHSMQWKQ-UHFFFAOYSA-N.
| Molecular formula | C13H23N3O3 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | TWVHPVFHSMQWKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(C2)/C(=N/O)/N |
Computed by PubChem (NCBI)