CAS 2060523-58-0 is the registry number for Ethyl 3-cyclopropyl-2-fluorobut-2-enoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (Z)-3-cyclopropyl-2-fluorobut-2-enoate (CAS 2060523-58-0) is a chemical compound with the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. IUPAC name: ethyl (Z)-3-cyclopropyl-2-fluorobut-2-enoate. InChIKey: OBERRPZQCSOPAQ-VURMDHGXSA-N.
| Molecular formula | C9H13FO2 |
|---|---|
| Molecular weight | 172.20 g/mol |
| IUPAC name | ethyl (Z)-3-cyclopropyl-2-fluorobut-2-enoate |
| InChIKey | OBERRPZQCSOPAQ-VURMDHGXSA-N |
| SMILES | CCOC(=O)/C(=C(\C)/C1CC1)/F |
Computed by PubChem (NCBI)