CAS 2061826-21-7 is the registry number for N-(3-Hydroxyphenyl)-4-((p-tolylthio)methyl)benzamide. Offered by: TRC. Available pack sizes: 500mg.
N-(3-hydroxyphenyl)-4-[(4-methylphenyl)sulfanylmethyl]benzamide (CAS 2061826-21-7) is a chemical compound with the molecular formula C21H19NO2S and a molecular weight of 349.4 g/mol. IUPAC name: N-(3-hydroxyphenyl)-4-[(4-methylphenyl)sulfanylmethyl]benzamide. InChIKey: YAOMEBDYUSTZMP-UHFFFAOYSA-N.
| Molecular formula | C21H19NO2S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-(3-hydroxyphenyl)-4-[(4-methylphenyl)sulfanylmethyl]benzamide |
| InChIKey | YAOMEBDYUSTZMP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SCC2=CC=C(C=C2)C(=O)NC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)