CAS 2061979-42-6 appears in our catalog under these names: Bis((6–bromopyridin–3–yl)methyl)amine, Bis((6-bromopyridin-3-yl)methyl)amine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-(6-bromo-3-pyridinyl)-N-[(6-bromo-3-pyridinyl)methyl]methanamine (CAS 2061979-42-6) is a chemical compound with the molecular formula C12H11Br2N3 and a molecular weight of 357.04 g/mol. IUPAC name: 1-(6-bromo-3-pyridinyl)-N-[(6-bromo-3-pyridinyl)methyl]methanamine. InChIKey: QIBDCNLRRVNAET-UHFFFAOYSA-N.
| Molecular formula | C12H11Br2N3 |
|---|---|
| Molecular weight | 357.04 g/mol |
| IUPAC name | 1-(6-bromo-3-pyridinyl)-N-[(6-bromo-3-pyridinyl)methyl]methanamine |
| InChIKey | QIBDCNLRRVNAET-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CNCC2=CN=C(C=C2)Br)Br |
Computed by PubChem (NCBI)