CAS 2061979-87-9 appears in our catalog under these names: tert-Butyl 5-aminoisoindoline-2-carboxylate oxalate(2:1), 95%, tert-Butyl 5-aminoisoindoline-2-carboxylate oxalate(2:1), 97%, tert–Butyl 5–aminoisoindoline–2–carboxylate oxalate(2:1), tert-Butyl 5-aminoisoindoline-2-carboxylate oxalate(2:1) 95%. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
Bis(tert-butyl 5-amino-1,3-dihydroisoindole-2-carboxylate);oxalic acid (CAS 2061979-87-9) is a chemical compound with the molecular formula C28H38N4O8 and a molecular weight of 558.6 g/mol. IUPAC name: bis(tert-butyl 5-amino-1,3-dihydroisoindole-2-carboxylate);oxalic acid. InChIKey: FRQMHMDMEUPZLX-UHFFFAOYSA-N.
| Molecular formula | C28H38N4O8 |
|---|---|
| Molecular weight | 558.6 g/mol |
| IUPAC name | bis(tert-butyl 5-amino-1,3-dihydroisoindole-2-carboxylate);oxalic acid |
| InChIKey | FRQMHMDMEUPZLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C=C(C=C2)N.CC(C)(C)OC(=O)N1CC2=C(C1)C=C(C=C2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)