CAS 2062-98-8 appears in our catalog under these names: Perfluoro(2–methyl–3–oxahexanoyl) fluoride, Perfluoro(2-methyl-3-oxahexanoyl) fluoride, 97% . Offered by: GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g, 5g.
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride (CAS 2062-98-8) is a chemical compound with the molecular formula C6F12O2 and a molecular weight of 332.04 g/mol. IUPAC name: 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride. InChIKey: BCLQALQSEBVVAD-UHFFFAOYSA-N.
| Molecular formula | C6F12O2 |
|---|---|
| Molecular weight | 332.04 g/mol |
| IUPAC name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride |
| InChIKey | BCLQALQSEBVVAD-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)F |
Computed by PubChem (NCBI)