CAS 2062613-30-1 is the registry number for N'-(2,6-Difluorobenzylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 2062613-30-1) is a chemical compound with the molecular formula C14H12F2N2O2S and a molecular weight of 310.32 g/mol. IUPAC name: N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: JBFITZANLQZQOF-RQZCQDPDSA-N.
| Molecular formula | C14H12F2N2O2S |
|---|---|
| Molecular weight | 310.32 g/mol |
| IUPAC name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | JBFITZANLQZQOF-RQZCQDPDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)