CAS 2062656-92-0 appears in our catalog under these names: 2,3-Diketogulonic Acid Potassium Salt (Technical Grade), 2,3-Diketogulonic acid potassium. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 2mg, 5mg.
CAS 2062656-92-0 identifies a chemical compound with the molecular formula C12H24KO14 and a molecular weight of 431.41 g/mol. InChIKey: MGGNUVCQTWGCEK-UHFFFAOYSA-N.
| Molecular formula | C12H24KO14 |
|---|---|
| Molecular weight | 431.41 g/mol |
| InChIKey | MGGNUVCQTWGCEK-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(=O)O)O)O)O)O)O.C(C(C(C(C(C(=O)O)O)O)O)O)O.[K] |
Computed by PubChem (NCBI)