CAS 2062663-68-5 appears in our catalog under these names: Boc-aminoxy-PEG4-acid, Boc–aminoxy–PEG4–acid, Boc-aminoxy-PEG4-acid 95%, 3,6,9,12,15-Pentaoxa-2-azaoctadecanedioic acid, 1-(1,1-dimethylethyl) ester, 95%, 95%, Boc-aminoxy-PEG4-acid, 98.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 100mg, 50mg, 250mg, 1g.
3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2062663-68-5) is a chemical compound with the molecular formula C16H31NO9 and a molecular weight of 381.42 g/mol. IUPAC name: 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: BIEZFNFAJFPHST-UHFFFAOYSA-N.
| Molecular formula | C16H31NO9 |
|---|---|
| Molecular weight | 381.42 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | BIEZFNFAJFPHST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)