CAS 20631-84-9 appears in our catalog under these names: Dimesitylborinic acid, 98%, Dimesitylborinic acid, Hydroxydimesitylborane 98%, Bis(2,4,6-trimethylphenyl)borinic acid, 98%, 98%, Dimesitylborinic acid, 98%,RG. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g.
Bis(2,4,6-trimethylphenyl)borinic acid (CAS 20631-84-9) is a chemical compound with the molecular formula C18H23BO and a molecular weight of 266.2 g/mol. IUPAC name: bis(2,4,6-trimethylphenyl)borinic acid. InChIKey: OTYVTANMHIUXBQ-UHFFFAOYSA-N.
| Molecular formula | C18H23BO |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | bis(2,4,6-trimethylphenyl)borinic acid |
| InChIKey | OTYVTANMHIUXBQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C)C)(C2=C(C=C(C=C2C)C)C)O |
Computed by PubChem (NCBI)