Products 20638-84-0
CAS 20638-84-0 is the registry number for Retinamide. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg.
(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (CAS 20638-84-0) is a chemical compound with the molecular formula C20H29NO and a molecular weight of 299.4 g/mol. IUPAC name: (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide. InChIKey: NUXWXMZVAHSICO-YCNIQYBTSA-N.
| Molecular formula | C20H29NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| InChIKey | NUXWXMZVAHSICO-YCNIQYBTSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C(=O)N)/C)/C |
Computed by PubChem (NCBI)