CAS 2064105-70-8 is the registry number for 6-Amino-8-chloro-4-(neopentylamino)quinoline-3-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-8-chloro-4-(2,2-dimethylpropylamino)quinoline-3-carbonitrile (CAS 2064105-70-8) is a chemical compound with the molecular formula C15H17ClN4 and a molecular weight of 288.77 g/mol. IUPAC name: 6-amino-8-chloro-4-(2,2-dimethylpropylamino)quinoline-3-carbonitrile. InChIKey: HSGWLLOJRBDULE-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN4 |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 6-amino-8-chloro-4-(2,2-dimethylpropylamino)quinoline-3-carbonitrile |
| InChIKey | HSGWLLOJRBDULE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CNC1=C2C=C(C=C(C2=NC=C1C#N)Cl)N |
Computed by PubChem (NCBI)