CAS 20644-12-6 appears in our catalog under these names: 1,12–DICARBADODECABORANE(12), p-Carborane, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g.
CAS 20644-12-6 identifies a chemical compound with the molecular formula C2H2B10 and a molecular weight of 134.2 g/mol. InChIKey: CFNUZRMHHJZBOM-UHFFFAOYSA-N.
| Molecular formula | C2H2B10 |
|---|---|
| Molecular weight | 134.2 g/mol |
| InChIKey | CFNUZRMHHJZBOM-UHFFFAOYSA-N |
| SMILES | [B]1[B][B][B]C2[B][B]C([B]2)[B][B][B]1 |
Computed by PubChem (NCBI)