Products 2065-23-8
CAS 2065-23-8 appears in our catalog under these names: Methyl phenoxyacetate, Methyl Phenoxyacetate, >99.0%(GC), Methyl 2-phenoxyacetate 98%, Methyl 2-phenoxyacetate, 98%, 98%, Methyl phenoxyacetate, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 25g, 10g, 100g, 1000g, 50g, 1kg.
Methyl 2-phenoxyacetate (CAS 2065-23-8) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: methyl 2-phenoxyacetate. InChIKey: BZCKRPHEZOHHBK-UHFFFAOYSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | methyl 2-phenoxyacetate |
| InChIKey | BZCKRPHEZOHHBK-UHFFFAOYSA-N |
| SMILES | COC(=O)COC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
methyl 2-phenoxyacetate, METHYL PHENOXYACETATE, Phenoxyacetic acid methyl ester, Acetic acid, phenoxy-, methyl ester, Acetic acid, 2-phenoxy-, methyl ester, InChI=1/C9H10O3/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H, METHYLPHENOXYACETATE, Methyl phenoxy acetate, Tafluprost Impurity 61, Tafluprost Impurity N76