CAS 2065-67-0 appears in our catalog under these names: Tetraphenylphosphonium iodide, Tetraphenylphosphonium iodide, 98+% , Tetraphenylphosphonium Iodide, >98.0%(HPLC), Tetraphenylphosphonium iodide 98%, Tetraphenylphosphonium iodide, 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 500g.
Tetraphenylphosphanium iodide (CAS 2065-67-0) is a chemical compound with the molecular formula C24H20IP and a molecular weight of 466.3 g/mol. IUPAC name: tetraphenylphosphanium iodide. InChIKey: AEFPPQGZJFTXDR-UHFFFAOYSA-M.
| Molecular formula | C24H20IP |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | tetraphenylphosphanium iodide |
| InChIKey | AEFPPQGZJFTXDR-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[I-] |
Computed by PubChem (NCBI)