CAS 2065250-23-7 is the registry number for 4-Fluoro-2-hydroxy-3,5-diiodo-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-fluoro-2-hydroxy-3,5-diiodobenzoic acid (CAS 2065250-23-7) is a chemical compound with the molecular formula C7H3FI2O3 and a molecular weight of 407.90 g/mol. IUPAC name: 4-fluoro-2-hydroxy-3,5-diiodobenzoic acid. InChIKey: XEMMQZPLOYUTPD-UHFFFAOYSA-N.
| Molecular formula | C7H3FI2O3 |
|---|---|
| Molecular weight | 407.90 g/mol |
| IUPAC name | 4-fluoro-2-hydroxy-3,5-diiodobenzoic acid |
| InChIKey | XEMMQZPLOYUTPD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1I)F)I)O)C(=O)O |
Computed by PubChem (NCBI)