Products 2065250-23-7

CAS 2065250-23-7 is the registry number for 4-Fluoro-2-hydroxy-3,5-diiodo-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-2-hydroxy-3,5-diiodobenzoic acid (CAS 2065250-23-7) is a chemical compound with the molecular formula C7H3FI2O3 and a molecular weight of 407.90 g/mol. IUPAC name: 4-fluoro-2-hydroxy-3,5-diiodobenzoic acid. InChIKey: XEMMQZPLOYUTPD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3FI2O3
Molecular weight407.90 g/mol
IUPAC name4-fluoro-2-hydroxy-3,5-diiodobenzoic acid
InChIKeyXEMMQZPLOYUTPD-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1I)F)I)O)C(=O)O

Computed by PubChem (NCBI)