CAS 2065250-30-6 is the registry number for (2-Bromo-6-fluoro-3-hydroxy-phenyl)-carbamic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl N-(2-bromo-6-fluoro-3-hydroxyphenyl)carbamate (CAS 2065250-30-6) is a chemical compound with the molecular formula C8H7BrFNO3 and a molecular weight of 264.05 g/mol. IUPAC name: methyl N-(2-bromo-6-fluoro-3-hydroxyphenyl)carbamate. InChIKey: GQTUWTKHAHOGNB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO3 |
|---|---|
| Molecular weight | 264.05 g/mol |
| IUPAC name | methyl N-(2-bromo-6-fluoro-3-hydroxyphenyl)carbamate |
| InChIKey | GQTUWTKHAHOGNB-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=C(C=CC(=C1Br)O)F |
Computed by PubChem (NCBI)