CAS 2065250-31-7 is the registry number for 6-Bromo-3,4-dichloro-5-fluoro-quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
6-bromo-3,4-dichloro-5-fluoroquinoline (CAS 2065250-31-7) is a chemical compound with the molecular formula C9H3BrCl2FN and a molecular weight of 294.93 g/mol. IUPAC name: 6-bromo-3,4-dichloro-5-fluoroquinoline. InChIKey: ILXVEVNBHGFUTP-UHFFFAOYSA-N.
| Molecular formula | C9H3BrCl2FN |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 6-bromo-3,4-dichloro-5-fluoroquinoline |
| InChIKey | ILXVEVNBHGFUTP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C(=C1Br)F)Cl)Cl |
Computed by PubChem (NCBI)