CAS 2065250-46-4 is the registry number for 5-Amino-2-iodo-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-amino-2-iodobenzoic acid;hydrochloride (CAS 2065250-46-4) is a chemical compound with the molecular formula C7H7ClINO2 and a molecular weight of 299.49 g/mol. IUPAC name: 5-amino-2-iodobenzoic acid;hydrochloride. InChIKey: YAOAVWSUXQYLEJ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClINO2 |
|---|---|
| Molecular weight | 299.49 g/mol |
| IUPAC name | 5-amino-2-iodobenzoic acid;hydrochloride |
| InChIKey | YAOAVWSUXQYLEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)I.Cl |
Computed by PubChem (NCBI)