Products 2065250-46-4

CAS 2065250-46-4 is the registry number for 5-Amino-2-iodo-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-amino-2-iodobenzoic acid;hydrochloride (CAS 2065250-46-4) is a chemical compound with the molecular formula C7H7ClINO2 and a molecular weight of 299.49 g/mol. IUPAC name: 5-amino-2-iodobenzoic acid;hydrochloride. InChIKey: YAOAVWSUXQYLEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClINO2
Molecular weight299.49 g/mol
IUPAC name5-amino-2-iodobenzoic acid;hydrochloride
InChIKeyYAOAVWSUXQYLEJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N)C(=O)O)I.Cl

Computed by PubChem (NCBI)