CAS 2065250-52-2 is the registry number for 6-Chloro-3-hydroxy-quinoline-2,4-dicarboxylic acid dimethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl 6-chloro-3-hydroxyquinoline-2,4-dicarboxylate (CAS 2065250-52-2) is a chemical compound with the molecular formula C13H10ClNO5 and a molecular weight of 295.67 g/mol. IUPAC name: dimethyl 6-chloro-3-hydroxyquinoline-2,4-dicarboxylate. InChIKey: WTTHDMQOLJHZPO-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO5 |
|---|---|
| Molecular weight | 295.67 g/mol |
| IUPAC name | dimethyl 6-chloro-3-hydroxyquinoline-2,4-dicarboxylate |
| InChIKey | WTTHDMQOLJHZPO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC2=C1C=C(C=C2)Cl)C(=O)OC)O |
Computed by PubChem (NCBI)