CAS 206557-08-6 appears in our catalog under these names: Sodium 4-aminobenzoate hydrate, 95+%, Sodium 4-aminobenzoate hydrate, 99%(HPLC),RG, 99%(HPLC),RG. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 5g, 25g, 100g, 500g.
Sodium;4-aminobenzoate;hydrate (CAS 206557-08-6) is a chemical compound with the molecular formula C7H8NNaO3 and a molecular weight of 177.13 g/mol. IUPAC name: sodium;4-aminobenzoate;hydrate. InChIKey: HWVSNYIAZJHZFQ-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | sodium;4-aminobenzoate;hydrate |
| InChIKey | HWVSNYIAZJHZFQ-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)[O-])N.O.[Na+] |
Computed by PubChem (NCBI)