Products 20663-28-9
CAS 20663-28-9 is the registry number for 2′-OMe-ADP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 20663-28-9) is a chemical compound with the molecular formula C11H17N5O10P2 and a molecular weight of 441.23 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: MIVZGIBAPZPJHJ-IOSLPCCCSA-N.
| Molecular formula | C11H17N5O10P2 |
|---|---|
| Molecular weight | 441.23 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | MIVZGIBAPZPJHJ-IOSLPCCCSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)