CAS 206646-04-0 is the registry number for Tenofovir monophosphate. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid (CAS 206646-04-0) is a chemical compound with the molecular formula C9H15N5O7P2 and a molecular weight of 367.19 g/mol. IUPAC name: [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid. InChIKey: BQDRSOMUPPCKPB-ZCFIWIBFSA-N.
| Molecular formula | C9H15N5O7P2 |
|---|---|
| Molecular weight | 367.19 g/mol |
| IUPAC name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid |
| InChIKey | BQDRSOMUPPCKPB-ZCFIWIBFSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)