Products 20665-63-8
CAS 20665-63-8 is the registry number for Tetrahydrofuran-2,2,5,5-d4, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g.
2,2,5,5-tetradeuteriooxolane (CAS 20665-63-8) is a chemical compound with the molecular formula C4H8O and a molecular weight of 76.13 g/mol. IUPAC name: 2,2,5,5-tetradeuteriooxolane. InChIKey: WYURNTSHIVDZCO-KHORGVISSA-N.
| Molecular formula | C4H8O |
|---|---|
| Molecular weight | 76.13 g/mol |
| IUPAC name | 2,2,5,5-tetradeuteriooxolane |
| InChIKey | WYURNTSHIVDZCO-KHORGVISSA-N |
| SMILES | [2H]C1(CCC(O1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)