CAS 206658-83-5 is the registry number for Sodium 4-aminohippurate hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g.
Sodium;2-[(4-aminobenzoyl)amino]acetate;hydrate (CAS 206658-83-5) is a chemical compound with the molecular formula C9H11N2NaO4 and a molecular weight of 234.18 g/mol. IUPAC name: sodium;2-[(4-aminobenzoyl)amino]acetate;hydrate. InChIKey: NHEPGWSIUUSKAY-UHFFFAOYSA-M.
| Molecular formula | C9H11N2NaO4 |
|---|---|
| Molecular weight | 234.18 g/mol |
| IUPAC name | sodium;2-[(4-aminobenzoyl)amino]acetate;hydrate |
| InChIKey | NHEPGWSIUUSKAY-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)[O-])N.O.[Na+] |
Computed by PubChem (NCBI)