CAS 2067-84-7 appears in our catalog under these names: 1H,4H-Pyrido[2,3-b]pyrazine-2,3-dione, 98%, Pyrido(2,3-b)pyrazine-2,3(1H,4H)-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (CAS 2067-84-7) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione. InChIKey: ZTCJWOFMAWQWRD-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | ZTCJWOFMAWQWRD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C(=O)N2)N=C1 |
Computed by PubChem (NCBI)