CAS 206885-38-3 is the registry number for Ronopterin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S)-1-(2,4-diamino-5,6,7,8-tetrahydropteridin-6-yl)propane-1,2-diol (CAS 206885-38-3) is a chemical compound with the molecular formula C9H16N6O2 and a molecular weight of 240.26 g/mol. IUPAC name: (1R,2S)-1-(2,4-diamino-5,6,7,8-tetrahydropteridin-6-yl)propane-1,2-diol. InChIKey: NDSDGUULXHNXGA-BYAPIUGTSA-N.
| Molecular formula | C9H16N6O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (1R,2S)-1-(2,4-diamino-5,6,7,8-tetrahydropteridin-6-yl)propane-1,2-diol |
| InChIKey | NDSDGUULXHNXGA-BYAPIUGTSA-N |
| SMILES | C[C@@H]([C@@H](C1CNC2=NC(=NC(=C2N1)N)N)O)O |
Computed by PubChem (NCBI)