CAS 2069934-29-6 appears in our catalog under these names: Dapagliflozin Impurity 99, Dapagliflozin Impurity 86, Dapagliflozin Impurity 48. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,4-dichloro-2-[(4-ethoxyphenyl)methyl]benzene (CAS 2069934-29-6) is a chemical compound with the molecular formula C15H14Cl2O and a molecular weight of 281.2 g/mol. IUPAC name: 1,4-dichloro-2-[(4-ethoxyphenyl)methyl]benzene. InChIKey: NJURDXZWUGNUHB-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 1,4-dichloro-2-[(4-ethoxyphenyl)methyl]benzene |
| InChIKey | NJURDXZWUGNUHB-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)