CAS 207-11-4 is the registry number for Acenaphtho[1,2-b]quinoxaline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Acenaphthyleno[1,2-b]quinoxaline (CAS 207-11-4) is a chemical compound with the molecular formula C18H10N2 and a molecular weight of 254.3 g/mol. IUPAC name: acenaphthyleno[1,2-b]quinoxaline. InChIKey: VRSLSEDOBUYIMM-UHFFFAOYSA-N.
| Molecular formula | C18H10N2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | acenaphthyleno[1,2-b]quinoxaline |
| InChIKey | VRSLSEDOBUYIMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C4=CC=CC5=C4C(=CC=C5)C3=N2 |
Computed by PubChem (NCBI)