CAS 2070009-45-7 appears in our catalog under these names: Fumarate hydratase-IN-2 sodium salt, Fumarate hydratase-IN-2 (sodium salt), 98.02%, 98.02%, Fumarate hydratase-IN-2 (sodium salt), 98.70%, Fumarate hydratase-IN-2 (sodium salt) (Standard). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg, 10 mg, 50 mg.
Sodium (3S,3aR)-3-[2-(methylamino)-2-oxoethyl]-2-oxo-1-[(4-phenylphenyl)methyl]-3,4,5,6-tetrahydroindole-3a-carboxylate (CAS 2070009-45-7) is a chemical compound with the molecular formula C25H25N2NaO4 and a molecular weight of 440.5 g/mol. IUPAC name: sodium (3S,3aR)-3-[2-(methylamino)-2-oxoethyl]-2-oxo-1-[(4-phenylphenyl)methyl]-3,4,5,6-tetrahydroindole-3a-carboxylate. InChIKey: KOACFUAVCMBNNV-RGFBGPCLSA-M.
| Molecular formula | C25H25N2NaO4 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | sodium (3S,3aR)-3-[2-(methylamino)-2-oxoethyl]-2-oxo-1-[(4-phenylphenyl)methyl]-3,4,5,6-tetrahydroindole-3a-carboxylate |
| InChIKey | KOACFUAVCMBNNV-RGFBGPCLSA-M |
| SMILES | CNC(=O)C[C@@H]1C(=O)N(C2=CCCC[C@@]12C(=O)[O-])CC3=CC=C(C=C3)C4=CC=CC=C4.[Na+] |
Computed by PubChem (NCBI)