Products 2070014-77-4
CAS 2070014-77-4 is the registry number for Ethyl 2-(di(tert-butoxycarbonyl)amino)-5-methylthiazole-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (CAS 2070014-77-4) is a chemical compound with the molecular formula C17H26N2O6S and a molecular weight of 386.5 g/mol. IUPAC name: ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: JTOFFOBQKWKJOF-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O6S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | JTOFFOBQKWKJOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)