CAS 2070015-13-1 appears in our catalog under these names: ML241 HCl, 98+%, ML241 hydrochloride/ 99.95% (existing batch purity), ML241 hydrochloride, ML241 hydrochloride, ML241 HCl 99%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200 mg, 50 mg.
N-benzyl-2-(2,3-dihydro-1,4-benzoxazin-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine;hydrochloride (CAS 2070015-13-1) is a chemical compound with the molecular formula C23H25ClN4O and a molecular weight of 408.9 g/mol. IUPAC name: N-benzyl-2-(2,3-dihydro-1,4-benzoxazin-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine;hydrochloride. InChIKey: DYHMHNNBOLCULH-UHFFFAOYSA-N.
| Molecular formula | C23H25ClN4O |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | N-benzyl-2-(2,3-dihydro-1,4-benzoxazin-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine;hydrochloride |
| InChIKey | DYHMHNNBOLCULH-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NC(=N2)N3CCOC4=CC=CC=C43)NCC5=CC=CC=C5.Cl |
Computed by PubChem (NCBI)